C16H27NO3S — CID 23540339
(3,5-ditert-butyl-2-methoxyanilino) methanesulfinate (PubChem CID 23540339) has the molecular formula C16H27NO3S and a molecular weight of 313.46 g/mol. Its IUPAC name is (3,5-ditert-butyl-2-methoxyanilino) methanesulfinate.
| Compound Name | (3,5-ditert-butyl-2-methoxyanilino) methanesulfinate |
|---|---|
| PubChem CID | 23540339 |
| Molecular Formula | C16H27NO3S |
| Molecular Weight | 313.46 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | (3,5-ditert-butyl-2-methoxyanilino) methanesulfinate |
| SMILES | COc1c(NOS(C)=O)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C16H27NO3S/c1-15(2,3)11-9-12(16(4,5)6)14(19-7)13(10-11)17-20-21(8)18/h9-10,17H,1-8H3 |
| InChIKey | ONBBNUJPIOBNRP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.46 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|