C15H27NO4S — CID 168869499
azanium 3,5-ditert-butyl-4-methoxybenzenesulfonate (PubChem CID 168869499) has the molecular formula C15H27NO4S and a molecular weight of 317.45 g/mol. Its IUPAC name is azanium 3,5-ditert-butyl-4-methoxybenzenesulfonate.
| Compound Name | azanium 3,5-ditert-butyl-4-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 168869499 |
| Molecular Formula | C15H27NO4S |
| Molecular Weight | 317.45 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | azanium 3,5-ditert-butyl-4-methoxybenzenesulfonate |
| SMILES | COc1c(C(C)(C)C)cc(S(=O)(=O)[O-])cc1C(C)(C)C.[NH4+] |
| InChI | InChI=1S/C15H24O4S.H3N/c1-14(2,3)11-8-10(20(16,17)18)9-12(13(11)19-7)15(4,5)6;/h8-9H,1-7H3,(H,16,17,18);1H3 |
| InChIKey | KNUQRRMVWQOPJT-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|