C11H8K2O7S2 — CID 167387667
dipotassium;6-methoxynaphthalene-1,3-disulfonate (PubChem CID 167387667) has the molecular formula C11H8K2O7S2 and a molecular weight of 394.51 g/mol. Its IUPAC name is dipotassium;6-methoxynaphthalene-1,3-disulfonate.
| Compound Name | dipotassium;6-methoxynaphthalene-1,3-disulfonate |
|---|---|
| PubChem CID | 167387667 |
| Molecular Formula | C11H8K2O7S2 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 393.90 |
| IUPAC Name | dipotassium;6-methoxynaphthalene-1,3-disulfonate |
| SMILES | COc1ccc2c(S(=O)(=O)[O-])cc(S(=O)(=O)[O-])cc2c1.[K+].[K+] |
| InChI | InChI=1S/C11H10O7S2.2K/c1-18-8-2-3-10-7(4-8)5-9(19(12,13)14)6-11(10)20(15,16)17;;/h2-6H,1H3,(H,12,13,14)(H,15,16,17);;/q;2*+1/p-2 |
| InChIKey | HGEOLUBBLQCHAN-UHFFFAOYSA-L |
| XLogP | -5.34 |
| TPSA | 123.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | -5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|