About 6-(furan-2-yl)naphthalene-1,3-disulfonate
6-(furan-2-yl)naphthalene-1,3-disulfonate (PubChem CID 168525686) has the molecular formula C14H8O7S2-2
and a molecular weight of 352.35 g/mol. Its IUPAC name is 6-(furan-2-yl)naphthalene-1,3-disulfonate.
Molecular Properties
| Compound Name | 6-(furan-2-yl)naphthalene-1,3-disulfonate |
| PubChem CID | 168525686 |
| Molecular Formula | C14H8O7S2-2 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 351.97 |
| IUPAC Name | 6-(furan-2-yl)naphthalene-1,3-disulfonate |
| SMILES | O=S(=O)([O-])c1cc(S(=O)(=O)[O-])c2ccc(-c3ccco3)cc2c1 |
| InChI | InChI=1S/C14H10O7S2/c15-22(16,17)11-7-10-6-9(13-2-1-5-21-13)3-4-12(10)14(8-11)23(18,19)20/h1-8H,(H,15,16,17)(H,18,19,20)/p-2 |
| InChIKey | GHZLLTPLMDMUTL-UHFFFAOYSA-L |
| XLogP | 1.91 |
| TPSA | 127.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 6-(furan-2-yl)naphthalene-1,3-disulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(furan-2-yl)naphthalene-1,3-disulfonate?
The IUPAC name of 6-(furan-2-yl)naphthalene-1,3-disulfonate (CID 168525686) is 6-(furan-2-yl)naphthalene-1,3-disulfonate.
What is the SMILES notation for 6-(furan-2-yl)naphthalene-1,3-disulfonate?
The canonical SMILES for 6-(furan-2-yl)naphthalene-1,3-disulfonate is O=S(=O)([O-])c1cc(S(=O)(=O)[O-])c2ccc(-c3ccco3)cc2c1.
What is the InChIKey of 6-(furan-2-yl)naphthalene-1,3-disulfonate?
The InChIKey is GHZLLTPLMDMUTL-UHFFFAOYSA-L. The full InChI is InChI=1S/C14H10O7S2/c15-22(16,17)11-7-10-6-9(13-2-1-5-21-13)3-4-12(10)14(8-11)23(18,19)20/h1-8H,(H,15,16,17)(H,18,19,20)/p-2.
What are the key properties of 6-(furan-2-yl)naphthalene-1,3-disulfonate?
6-(furan-2-yl)naphthalene-1,3-disulfonate has a molecular weight of 352.35 g/mol, XLogP of 1.91, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(furan-2-yl)naphthalene-1,3-disulfonate is sourced from PubChem (CID 168525686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).