C10H7BNa2O8S2 — CID 25229311
disodium;6-borononaphthalene-1,3-disulfonate (PubChem CID 25229311) has the molecular formula C10H7BNa2O8S2 and a molecular weight of 376.08 g/mol. Its IUPAC name is disodium;6-borononaphthalene-1,3-disulfonate.
| Compound Name | disodium;6-borononaphthalene-1,3-disulfonate |
|---|---|
| PubChem CID | 25229311 |
| Molecular Formula | C10H7BNa2O8S2 |
| Molecular Weight | 376.08 g/mol |
| Exact Mass | 375.95 |
| IUPAC Name | disodium;6-borononaphthalene-1,3-disulfonate |
| SMILES | O=S(=O)([O-])c1cc(S(=O)(=O)[O-])c2ccc(B(O)O)cc2c1.[Na+].[Na+] |
| InChI | InChI=1S/C10H9BO8S2.2Na/c12-11(13)7-1-2-9-6(3-7)4-8(20(14,15)16)5-10(9)21(17,18)19;;/h1-5,12-13H,(H,14,15,16)(H,17,18,19);;/q;2*+1/p-2 |
| InChIKey | OAUZMQHLSNPUSE-UHFFFAOYSA-L |
| XLogP | -7.66 |
| TPSA | 154.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.08 |
| LogP ≤ 5 | -7.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|