C15H24IOP — CID 174881075
(3,5-ditert-butyl-4-methoxyphenyl)-iodophosphane (PubChem CID 174881075) has the molecular formula C15H24IOP and a molecular weight of 378.23 g/mol. Its IUPAC name is (3,5-ditert-butyl-4-methoxyphenyl)-iodophosphane.
| Compound Name | (3,5-ditert-butyl-4-methoxyphenyl)-iodophosphane |
|---|---|
| PubChem CID | 174881075 |
| Molecular Formula | C15H24IOP |
| Molecular Weight | 378.23 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | (3,5-ditert-butyl-4-methoxyphenyl)-iodophosphane |
| SMILES | COc1c(C(C)(C)C)cc(PI)cc1C(C)(C)C |
| InChI | InChI=1S/C15H24IOP/c1-14(2,3)11-8-10(18-16)9-12(13(11)17-7)15(4,5)6/h8-9,18H,1-7H3 |
| InChIKey | HTFPSPNXBLNNNB-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.23 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|