C14H22O2 — CID 173207102
1-tert-butyl-2,3-dimethoxy-4,5-dimethylbenzene (PubChem CID 173207102) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is 1-tert-butyl-2,3-dimethoxy-4,5-dimethylbenzene.
| Compound Name | 1-tert-butyl-2,3-dimethoxy-4,5-dimethylbenzene |
|---|---|
| PubChem CID | 173207102 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 1-tert-butyl-2,3-dimethoxy-4,5-dimethylbenzene |
| SMILES | COc1c(C(C)(C)C)cc(C)c(C)c1OC |
| InChI | InChI=1S/C14H22O2/c1-9-8-11(14(3,4)5)13(16-7)12(15-6)10(9)2/h8H,1-7H3 |
| InChIKey | PDXGZCWJRIOJCO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |