C15H25BO3 — CID 74891306
(3,5-ditert-butyl-4-methoxyphenyl)boronic acid (PubChem CID 74891306) has the molecular formula C15H25BO3 and a molecular weight of 264.17 g/mol. Its IUPAC name is (3,5-ditert-butyl-4-methoxyphenyl)boronic acid.
| Compound Name | (3,5-ditert-butyl-4-methoxyphenyl)boronic acid |
|---|---|
| PubChem CID | 74891306 |
| Molecular Formula | C15H25BO3 |
| Molecular Weight | 264.17 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | (3,5-ditert-butyl-4-methoxyphenyl)boronic acid |
| SMILES | COc1c(C(C)(C)C)cc(B(O)O)cc1C(C)(C)C |
| InChI | InChI=1S/C15H25BO3/c1-14(2,3)11-8-10(16(17)18)9-12(13(11)19-7)15(4,5)6/h8-9,17-18H,1-7H3 |
| InChIKey | CIYHLDPTVFBRGD-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.17 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|