C15H23O2P — CID 70140823
1,3-ditert-butyl-2-methoxy-5-phosphorosobenzene (PubChem CID 70140823) has the molecular formula C15H23O2P and a molecular weight of 266.32 g/mol. Its IUPAC name is 1,3-ditert-butyl-2-methoxy-5-phosphorosobenzene.
| Compound Name | 1,3-ditert-butyl-2-methoxy-5-phosphorosobenzene |
|---|---|
| PubChem CID | 70140823 |
| Molecular Formula | C15H23O2P |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 1,3-ditert-butyl-2-methoxy-5-phosphorosobenzene |
| SMILES | COc1c(C(C)(C)C)cc(P=O)cc1C(C)(C)C |
| InChI | InChI=1S/C15H23O2P/c1-14(2,3)11-8-10(18-16)9-12(13(11)17-7)15(4,5)6/h8-9H,1-7H3 |
| InChIKey | XAPQRNQYRDWVST-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|