C22H34FO5P — CID 87871950
1-(3,5-ditert-butyl-2-methoxyphenyl)-4-fluoro-4-[methoxy(methyl)phosphoryl]oxypent-1-en-3-one (PubChem CID 87871950) has the molecular formula C22H34FO5P and a molecular weight of 428.48 g/mol. Its IUPAC name is 1-(3,5-ditert-butyl-2-methoxyphenyl)-4-fluoro-4-[methoxy(methyl)phosphoryl]oxypent-1-en-3-one.
| Compound Name | 1-(3,5-ditert-butyl-2-methoxyphenyl)-4-fluoro-4-[methoxy(methyl)phosphoryl]oxypent-1-en-3-one |
|---|---|
| PubChem CID | 87871950 |
| Molecular Formula | C22H34FO5P |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 1-(3,5-ditert-butyl-2-methoxyphenyl)-4-fluoro-4-[methoxy(methyl)phosphoryl]oxypent-1-en-3-one |
| SMILES | COc1c(C=CC(=O)C(C)(F)OP(C)(=O)OC)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C22H34FO5P/c1-20(2,3)16-13-15(19(26-8)17(14-16)21(4,5)6)11-12-18(24)22(7,23)28-29(10,25)27-9/h11-14H,1-10H3 |
| InChIKey | CJWWNIVWIWEHIC-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|