C26H34O4 — CID 163079799
1-(3,5-ditert-butyl-4-methoxyphenyl)-3-(2,5-dimethoxyphenyl)prop-2-en-1-one (PubChem CID 163079799) has the molecular formula C26H34O4 and a molecular weight of 410.55 g/mol. Its IUPAC name is 1-(3,5-ditert-butyl-4-methoxyphenyl)-3-(2,5-dimethoxyphenyl)prop-2-en-1-one.
| Compound Name | 1-(3,5-ditert-butyl-4-methoxyphenyl)-3-(2,5-dimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 163079799 |
| Molecular Formula | C26H34O4 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | 1-(3,5-ditert-butyl-4-methoxyphenyl)-3-(2,5-dimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(OC)c(C=CC(=O)c2cc(C(C)(C)C)c(OC)c(C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C26H34O4/c1-25(2,3)20-15-18(16-21(24(20)30-9)26(4,5)6)22(27)12-10-17-14-19(28-7)11-13-23(17)29-8/h10-16H,1-9H3 |
| InChIKey | GFDQEQZNQFYOPJ-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|