C14H22NO4P — CID 152515501
(5-tert-butyl-3-dimethylphosphoryl-2-methoxyphenyl) carbamate (PubChem CID 152515501) has the molecular formula C14H22NO4P and a molecular weight of 299.31 g/mol. Its IUPAC name is (5-tert-butyl-3-dimethylphosphoryl-2-methoxyphenyl) carbamate.
| Compound Name | (5-tert-butyl-3-dimethylphosphoryl-2-methoxyphenyl) carbamate |
|---|---|
| PubChem CID | 152515501 |
| Molecular Formula | C14H22NO4P |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | (5-tert-butyl-3-dimethylphosphoryl-2-methoxyphenyl) carbamate |
| SMILES | COc1c(OC(N)=O)cc(C(C)(C)C)cc1P(C)(C)=O |
| InChI | InChI=1S/C14H22NO4P/c1-14(2,3)9-7-10(19-13(15)16)12(18-4)11(8-9)20(5,6)17/h7-8H,1-6H3,(H2,15,16) |
| InChIKey | YGKJFERDTIIGBS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|