C23H37O5P — CID 91607907
4-(3,5-ditert-butyl-2-methoxyphenyl)-1-[ethoxy(ethyl)phosphoryl]oxybut-3-en-2-one (PubChem CID 91607907) has the molecular formula C23H37O5P and a molecular weight of 424.52 g/mol. Its IUPAC name is 4-(3,5-ditert-butyl-2-methoxyphenyl)-1-[ethoxy(ethyl)phosphoryl]oxybut-3-en-2-one.
| Compound Name | 4-(3,5-ditert-butyl-2-methoxyphenyl)-1-[ethoxy(ethyl)phosphoryl]oxybut-3-en-2-one |
|---|---|
| PubChem CID | 91607907 |
| Molecular Formula | C23H37O5P |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | 4-(3,5-ditert-butyl-2-methoxyphenyl)-1-[ethoxy(ethyl)phosphoryl]oxybut-3-en-2-one |
| SMILES | CCOP(=O)(CC)OCC(=O)C=Cc1cc(C(C)(C)C)cc(C(C)(C)C)c1OC |
| InChI | InChI=1S/C23H37O5P/c1-10-27-29(25,11-2)28-16-19(24)13-12-17-14-18(22(3,4)5)15-20(21(17)26-9)23(6,7)8/h12-15H,10-11,16H2,1-9H3 |
| InChIKey | OKIIKSYNZZUMGA-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|