C34H50O3 — CID 21290800
[2,4-ditert-butyl-6-[1-(3,5-ditert-butyl-2-hydroxyphenyl)ethyl]phenyl] 2-methylprop-2-enoate (PubChem CID 21290800) has the molecular formula C34H50O3 and a molecular weight of 506.77 g/mol. Its IUPAC name is [2,4-ditert-butyl-6-[1-(3,5-ditert-butyl-2-hydroxyphenyl)ethyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [2,4-ditert-butyl-6-[1-(3,5-ditert-butyl-2-hydroxyphenyl)ethyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 21290800 |
| Molecular Formula | C34H50O3 |
| Molecular Weight | 506.77 g/mol |
| Exact Mass | 506.38 |
| IUPAC Name | [2,4-ditert-butyl-6-[1-(3,5-ditert-butyl-2-hydroxyphenyl)ethyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1c(C(C)c2cc(C(C)(C)C)cc(C(C)(C)C)c2O)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C34H50O3/c1-20(2)30(36)37-29-25(17-23(32(7,8)9)19-27(29)34(13,14)15)21(3)24-16-22(31(4,5)6)18-26(28(24)35)33(10,11)12/h16-19,21,35H,1H2,2-15H3 |
| InChIKey | MBQVCCDSYKOCMI-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.77 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|