C33H44O4 — CID 18629559
[2-tert-butyl-6-[[3-tert-butyl-5-ethyl-2-(2-methylprop-2-enoyloxy)phenyl]methyl]-4-ethylphenyl] 2-methylprop-2-enoate (PubChem CID 18629559) has the molecular formula C33H44O4 and a molecular weight of 504.71 g/mol. Its IUPAC name is [2-tert-butyl-6-[[3-tert-butyl-5-ethyl-2-(2-methylprop-2-enoyloxy)phenyl]methyl]-4-ethylphenyl] 2-methylprop-2-enoate.
| Compound Name | [2-tert-butyl-6-[[3-tert-butyl-5-ethyl-2-(2-methylprop-2-enoyloxy)phenyl]methyl]-4-ethylphenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 18629559 |
| Molecular Formula | C33H44O4 |
| Molecular Weight | 504.71 g/mol |
| Exact Mass | 504.32 |
| IUPAC Name | [2-tert-butyl-6-[[3-tert-butyl-5-ethyl-2-(2-methylprop-2-enoyloxy)phenyl]methyl]-4-ethylphenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1c(Cc2cc(CC)cc(C(C)(C)C)c2OC(=O)C(=C)C)cc(CC)cc1C(C)(C)C |
| InChI | InChI=1S/C33H44O4/c1-13-22-15-24(28(36-30(34)20(3)4)26(17-22)32(7,8)9)19-25-16-23(14-2)18-27(33(10,11)12)29(25)37-31(35)21(5)6/h15-18H,3,5,13-14,19H2,1-2,4,6-12H3 |
| InChIKey | FVDFTZFOSSGEMI-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.71 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|