(3,5-diethyl-4-hydroxyphenyl) 2-methylprop-2-enoate

C14H18O3 — CID 155661971

IUPAC(3,5-diethyl-4-hydroxyphenyl) 2-methylprop-2-enoate
SMILESC=C(C)C(=O)Oc1cc(CC)c(O)c(CC)c1
InChIInChI=1S/C14H18O3/c1-5-10-7-12(17-14(16)9(3)4)8-11(6-2)13(10)15/h7-8,15H,3,5-6H2,1-2,4H3
InChIKeyYUIHXRGVCWWPHH-UHFFFAOYSA-N
MW234.29 g/mol
LogP3.00
Rot. Bonds4

About (3,5-diethyl-4-hydroxyphenyl) 2-methylprop-2-enoate

(3,5-diethyl-4-hydroxyphenyl) 2-methylprop-2-enoate (PubChem CID 155661971) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is (3,5-diethyl-4-hydroxyphenyl) 2-methylprop-2-enoate.

Molecular Properties

Compound Name(3,5-diethyl-4-hydroxyphenyl) 2-methylprop-2-enoate
PubChem CID155661971
Molecular FormulaC14H18O3
Molecular Weight234.29 g/mol
Exact Mass234.13
IUPAC Name(3,5-diethyl-4-hydroxyphenyl) 2-methylprop-2-enoate
SMILESC=C(C)C(=O)Oc1cc(CC)c(O)c(CC)c1
InChIInChI=1S/C14H18O3/c1-5-10-7-12(17-14(16)9(3)4)8-11(6-2)13(10)15/h7-8,15H,3,5-6H2,1-2,4H3
InChIKeyYUIHXRGVCWWPHH-UHFFFAOYSA-N
XLogP3.00
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500234.29
LogP ≤ 53.00
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze (3,5-diethyl-4-hydroxyphenyl) 2-methylprop-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3,5-diethyl-4-hydroxyphenyl) 2-methylprop-2-enoate?
The IUPAC name of (3,5-diethyl-4-hydroxyphenyl) 2-methylprop-2-enoate (CID 155661971) is (3,5-diethyl-4-hydroxyphenyl) 2-methylprop-2-enoate.
What is the SMILES notation for (3,5-diethyl-4-hydroxyphenyl) 2-methylprop-2-enoate?
The canonical SMILES for (3,5-diethyl-4-hydroxyphenyl) 2-methylprop-2-enoate is C=C(C)C(=O)Oc1cc(CC)c(O)c(CC)c1.
What is the InChIKey of (3,5-diethyl-4-hydroxyphenyl) 2-methylprop-2-enoate?
The InChIKey is YUIHXRGVCWWPHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O3/c1-5-10-7-12(17-14(16)9(3)4)8-11(6-2)13(10)15/h7-8,15H,3,5-6H2,1-2,4H3.
What are the key properties of (3,5-diethyl-4-hydroxyphenyl) 2-methylprop-2-enoate?
(3,5-diethyl-4-hydroxyphenyl) 2-methylprop-2-enoate has a molecular weight of 234.29 g/mol, XLogP of 3.00, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-diethyl-4-hydroxyphenyl) 2-methylprop-2-enoate is sourced from PubChem (CID 155661971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).