C18H17IO2 — CID 146271671
[4-(3-ethyl-4-iodophenyl)phenyl] 2-methylprop-2-enoate (PubChem CID 146271671) has the molecular formula C18H17IO2 and a molecular weight of 392.24 g/mol. Its IUPAC name is [4-(3-ethyl-4-iodophenyl)phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-(3-ethyl-4-iodophenyl)phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 146271671 |
| Molecular Formula | C18H17IO2 |
| Molecular Weight | 392.24 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | [4-(3-ethyl-4-iodophenyl)phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc(I)c(CC)c2)cc1 |
| InChI | InChI=1S/C18H17IO2/c1-4-13-11-15(7-10-17(13)19)14-5-8-16(9-6-14)21-18(20)12(2)3/h5-11H,2,4H2,1,3H3 |
| InChIKey | DPRWCUCUELLCLK-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.24 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|