C24H26O6 — CID 147030807
[4-[3,5-bis(methoxymethyl)-4-(2-methylprop-2-enoyloxy)phenyl]phenyl] 2-methylprop-2-enoate (PubChem CID 147030807) has the molecular formula C24H26O6 and a molecular weight of 410.47 g/mol. Its IUPAC name is [4-[3,5-bis(methoxymethyl)-4-(2-methylprop-2-enoyloxy)phenyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[3,5-bis(methoxymethyl)-4-(2-methylprop-2-enoyloxy)phenyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 147030807 |
| Molecular Formula | C24H26O6 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | [4-[3,5-bis(methoxymethyl)-4-(2-methylprop-2-enoyloxy)phenyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2cc(COC)c(OC(=O)C(=C)C)c(COC)c2)cc1 |
| InChI | InChI=1S/C24H26O6/c1-15(2)23(25)29-21-9-7-17(8-10-21)18-11-19(13-27-5)22(20(12-18)14-28-6)30-24(26)16(3)4/h7-12H,1,3,13-14H2,2,4-6H3 |
| InChIKey | AXOJHTCENNXMSH-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|