C33H50Br2O2 — CID 139649087
2-(4-bromobutoxy)-1-[[2-(4-bromobutoxy)-3-tert-butyl-5-ethylphenyl]methyl]-3-tert-butyl-5-ethylbenzene (PubChem CID 139649087) has the molecular formula C33H50Br2O2 and a molecular weight of 638.57 g/mol. Its IUPAC name is 2-(4-bromobutoxy)-1-[[2-(4-bromobutoxy)-3-tert-butyl-5-ethylphenyl]methyl]-3-tert-butyl-5-ethylbenzene.
| Compound Name | 2-(4-bromobutoxy)-1-[[2-(4-bromobutoxy)-3-tert-butyl-5-ethylphenyl]methyl]-3-tert-butyl-5-ethylbenzene |
|---|---|
| PubChem CID | 139649087 |
| Molecular Formula | C33H50Br2O2 |
| Molecular Weight | 638.57 g/mol |
| Exact Mass | 636.22 |
| IUPAC Name | 2-(4-bromobutoxy)-1-[[2-(4-bromobutoxy)-3-tert-butyl-5-ethylphenyl]methyl]-3-tert-butyl-5-ethylbenzene |
| SMILES | CCc1cc(Cc2cc(CC)cc(C(C)(C)C)c2OCCCCBr)c(OCCCCBr)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C33H50Br2O2/c1-9-24-19-26(30(36-17-13-11-15-34)28(21-24)32(3,4)5)23-27-20-25(10-2)22-29(33(6,7)8)31(27)37-18-14-12-16-35/h19-22H,9-18,23H2,1-8H3 |
| InChIKey | QEQICQYJAFFIMZ-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.57 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|