C18H28O3 — CID 118443288
tert-butyl (2-tert-butyl-4-ethyl-6-methylphenyl) carbonate (PubChem CID 118443288) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is tert-butyl (2-tert-butyl-4-ethyl-6-methylphenyl) carbonate.
| Compound Name | tert-butyl (2-tert-butyl-4-ethyl-6-methylphenyl) carbonate |
|---|---|
| PubChem CID | 118443288 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | tert-butyl (2-tert-butyl-4-ethyl-6-methylphenyl) carbonate |
| SMILES | CCc1cc(C)c(OC(=O)OC(C)(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H28O3/c1-9-13-10-12(2)15(14(11-13)17(3,4)5)20-16(19)21-18(6,7)8/h10-11H,9H2,1-8H3 |
| InChIKey | IMISJSPEZQYIJQ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|