C52H73O4P — CID 139721792
2,4-ditert-butyl-6-[1-[3,5-ditert-butyl-2-(4,8-ditert-butyl-2,10-dimethylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxyphenyl]ethyl]phenol (PubChem CID 139721792) has the molecular formula C52H73O4P and a molecular weight of 793.13 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[1-[3,5-ditert-butyl-2-(4,8-ditert-butyl-2,10-dimethylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxyphenyl]ethyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[1-[3,5-ditert-butyl-2-(4,8-ditert-butyl-2,10-dimethylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxyphenyl]ethyl]phenol |
|---|---|
| PubChem CID | 139721792 |
| Molecular Formula | C52H73O4P |
| Molecular Weight | 793.13 g/mol |
| Exact Mass | 792.52 |
| IUPAC Name | 2,4-ditert-butyl-6-[1-[3,5-ditert-butyl-2-(4,8-ditert-butyl-2,10-dimethylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxyphenyl]ethyl]phenol |
| SMILES | Cc1cc(C(C)(C)C)c2op(Oc3c(C(C)c4cc(C(C)(C)C)cc(C(C)(C)C)c4O)cc(C(C)(C)C)cc3C(C)(C)C)oc3c(C(C)(C)C)cc(C)cc3c2c1 |
| InChI | InChI=1S/C52H73O4P/c1-30-22-37-38-23-31(2)25-41(51(16,17)18)46(38)56-57(55-45(37)40(24-30)50(13,14)15)54-44-36(27-34(48(7,8)9)29-42(44)52(19,20)21)32(3)35-26-33(47(4,5)6)28-39(43(35)53)49(10,11)12/h22-29,32,53H,1-21H3 |
| InChIKey | CXFQGLKDVLPQIU-UHFFFAOYSA-N |
| XLogP | 16.39 |
| TPSA | 55.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.13 |
| LogP ≤ 5 | 16.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |