C30H46NO3P — CID 159117358
1-(2,4,8,10-tetratert-butylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxyethanamine (PubChem CID 159117358) has the molecular formula C30H46NO3P and a molecular weight of 499.68 g/mol. Its IUPAC name is 1-(2,4,8,10-tetratert-butylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxyethanamine.
| Compound Name | 1-(2,4,8,10-tetratert-butylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxyethanamine |
|---|---|
| PubChem CID | 159117358 |
| Molecular Formula | C30H46NO3P |
| Molecular Weight | 499.68 g/mol |
| Exact Mass | 499.32 |
| IUPAC Name | 1-(2,4,8,10-tetratert-butylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxyethanamine |
| SMILES | CC(N)Op1oc2c(C(C)(C)C)cc(C(C)(C)C)cc2c2cc(C(C)(C)C)cc(C(C)(C)C)c2o1 |
| InChI | InChI=1S/C30H46NO3P/c1-18(31)32-35-33-25-21(14-19(27(2,3)4)16-23(25)29(8,9)10)22-15-20(28(5,6)7)17-24(26(22)34-35)30(11,12)13/h14-18H,31H2,1-13H3 |
| InChIKey | KFGHCNSVFRSQAU-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 61.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.68 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|