C40H57N2O4P — CID 102597386
1-[(2S)-3-methyl-1-(2,4,8,10-tetratert-butylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxybutan-2-yl]-3-phenylurea (PubChem CID 102597386) has the molecular formula C40H57N2O4P and a molecular weight of 660.88 g/mol. Its IUPAC name is 1-[(2S)-3-methyl-1-(2,4,8,10-tetratert-butylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxybutan-2-yl]-3-phenylurea.
| Compound Name | 1-[(2S)-3-methyl-1-(2,4,8,10-tetratert-butylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxybutan-2-yl]-3-phenylurea |
|---|---|
| PubChem CID | 102597386 |
| Molecular Formula | C40H57N2O4P |
| Molecular Weight | 660.88 g/mol |
| Exact Mass | 660.41 |
| IUPAC Name | 1-[(2S)-3-methyl-1-(2,4,8,10-tetratert-butylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxybutan-2-yl]-3-phenylurea |
| SMILES | CC(C)[C@@H](COp1oc2c(C(C)(C)C)cc(C(C)(C)C)cc2c2cc(C(C)(C)C)cc(C(C)(C)C)c2o1)NC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C40H57N2O4P/c1-25(2)33(42-36(43)41-28-18-16-15-17-19-28)24-44-47-45-34-29(20-26(37(3,4)5)22-31(34)39(9,10)11)30-21-27(38(6,7)8)23-32(35(30)46-47)40(12,13)14/h15-23,25,33H,24H2,1-14H3,(H2,41,42,43)/t33-/m1/s1 |
| InChIKey | UYRYNXZVGSVLEK-MGBGTMOVSA-N |
| XLogP | 11.75 |
| TPSA | 76.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.88 |
| LogP ≤ 5 | 11.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |