C70H94N6O6 — CID 101437544
1-[2-[2-[bis[3,5-ditert-butyl-2-[2-(phenylcarbamoylamino)ethoxy]phenyl]methyl]-4,6-ditert-butylphenoxy]ethyl]-3-phenylurea (PubChem CID 101437544) has the molecular formula C70H94N6O6 and a molecular weight of 1115.56 g/mol. Its IUPAC name is 1-[2-[2-[bis[3,5-ditert-butyl-2-[2-(phenylcarbamoylamino)ethoxy]phenyl]methyl]-4,6-ditert-butylphenoxy]ethyl]-3-phenylurea.
| Compound Name | 1-[2-[2-[bis[3,5-ditert-butyl-2-[2-(phenylcarbamoylamino)ethoxy]phenyl]methyl]-4,6-ditert-butylphenoxy]ethyl]-3-phenylurea |
|---|---|
| PubChem CID | 101437544 |
| Molecular Formula | C70H94N6O6 |
| Molecular Weight | 1115.56 g/mol |
| Exact Mass | 1114.72 |
| IUPAC Name | 1-[2-[2-[bis[3,5-ditert-butyl-2-[2-(phenylcarbamoylamino)ethoxy]phenyl]methyl]-4,6-ditert-butylphenoxy]ethyl]-3-phenylurea |
| SMILES | CC(C)(C)c1cc(C(c2cc(C(C)(C)C)cc(C(C)(C)C)c2OCCNC(=O)Nc2ccccc2)c2cc(C(C)(C)C)cc(C(C)(C)C)c2OCCNC(=O)Nc2ccccc2)c(OCCNC(=O)Nc2ccccc2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C70H94N6O6/c1-65(2,3)46-40-52(59(55(43-46)68(10,11)12)80-37-34-71-62(77)74-49-28-22-19-23-29-49)58(53-41-47(66(4,5)6)44-56(69(13,14)15)60(53)81-38-35-72-63(78)75-50-30-24-20-25-31-50)54-42-48(67(7,8)9)45-57(70(16,17)18)61(54)82-39-36-73-64(79)76-51-32-26-21-27-33-51/h19-33,40-45,58H,34-39H2,1-18H3,(H2,71,74,77)(H2,72,75,78)(H2,73,76,79) |
| InChIKey | FPWCUEXWGYBNDI-UHFFFAOYSA-N |
| XLogP | 16.25 |
| TPSA | 151.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 82 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1115.56 |
| LogP ≤ 5 | 16.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|