C42H60N3O3P — CID 102597388
1-benzyl-3-[(1S,2S)-2-[(2,4,8,10-tetratert-butylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)amino]cyclohexyl]urea (PubChem CID 102597388) has the molecular formula C42H60N3O3P and a molecular weight of 685.93 g/mol. Its IUPAC name is 1-benzyl-3-[(1S,2S)-2-[(2,4,8,10-tetratert-butylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)amino]cyclohexyl]urea.
| Compound Name | 1-benzyl-3-[(1S,2S)-2-[(2,4,8,10-tetratert-butylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)amino]cyclohexyl]urea |
|---|---|
| PubChem CID | 102597388 |
| Molecular Formula | C42H60N3O3P |
| Molecular Weight | 685.93 g/mol |
| Exact Mass | 685.44 |
| IUPAC Name | 1-benzyl-3-[(1S,2S)-2-[(2,4,8,10-tetratert-butylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)amino]cyclohexyl]urea |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c2op(N[C@H]3CCCC[C@@H]3NC(=O)NCc3ccccc3)oc3c(C(C)(C)C)cc(C(C)(C)C)cc3c2c1 |
| InChI | InChI=1S/C42H60N3O3P/c1-39(2,3)28-22-30-31-23-29(40(4,5)6)25-33(42(10,11)12)37(31)48-49(47-36(30)32(24-28)41(7,8)9)45-35-21-17-16-20-34(35)44-38(46)43-26-27-18-14-13-15-19-27/h13-15,18-19,22-25,34-35,45H,16-17,20-21,26H2,1-12H3,(H2,43,44,46)/t34-,35-/m0/s1 |
| InChIKey | GIZHGPQXGBWZNE-PXLJZGITSA-N |
| XLogP | 11.83 |
| TPSA | 79.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.93 |
| LogP ≤ 5 | 11.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |