C22H33N3O2 — CID 89490434
1-benzyl-3-[(1R,2S)-2-(3,3-dimethylpiperidine-1-carbonyl)cyclohexyl]urea (PubChem CID 89490434) has the molecular formula C22H33N3O2 and a molecular weight of 371.52 g/mol. Its IUPAC name is 1-benzyl-3-[(1R,2S)-2-(3,3-dimethylpiperidine-1-carbonyl)cyclohexyl]urea.
| Compound Name | 1-benzyl-3-[(1R,2S)-2-(3,3-dimethylpiperidine-1-carbonyl)cyclohexyl]urea |
|---|---|
| PubChem CID | 89490434 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | 1-benzyl-3-[(1R,2S)-2-(3,3-dimethylpiperidine-1-carbonyl)cyclohexyl]urea |
| SMILES | CC1(C)CCCN(C(=O)[C@H]2CCCC[C@H]2NC(=O)NCc2ccccc2)C1 |
| InChI | InChI=1S/C22H33N3O2/c1-22(2)13-8-14-25(16-22)20(26)18-11-6-7-12-19(18)24-21(27)23-15-17-9-4-3-5-10-17/h3-5,9-10,18-19H,6-8,11-16H2,1-2H3,(H2,23,24,27)/t18-,19+/m0/s1 |
| InChIKey | TZEBNWGSMRAXCD-RBUKOAKNSA-N |
| XLogP | 3.69 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |