C22H27N3O2 — CID 53117404
1-N,3-N-dibenzyl-3-methylpiperidine-1,3-dicarboxamide (PubChem CID 53117404) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is 1-N,3-N-dibenzyl-3-methylpiperidine-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-dibenzyl-3-methylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 53117404 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 1-N,3-N-dibenzyl-3-methylpiperidine-1,3-dicarboxamide |
| SMILES | CC1(C(=O)NCc2ccccc2)CCCN(C(=O)NCc2ccccc2)C1 |
| InChI | InChI=1S/C22H27N3O2/c1-22(20(26)23-15-18-9-4-2-5-10-18)13-8-14-25(17-22)21(27)24-16-19-11-6-3-7-12-19/h2-7,9-12H,8,13-17H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | GBQRAHNGVRXXRV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |