C23H29N3O3 — CID 93071343
(3S)-3-N-benzyl-1-N-(2-ethoxyphenyl)-3-methylpiperidine-1,3-dicarboxamide (PubChem CID 93071343) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is (3S)-3-N-benzyl-1-N-(2-ethoxyphenyl)-3-methylpiperidine-1,3-dicarboxamide.
| Compound Name | (3S)-3-N-benzyl-1-N-(2-ethoxyphenyl)-3-methylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 93071343 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | (3S)-3-N-benzyl-1-N-(2-ethoxyphenyl)-3-methylpiperidine-1,3-dicarboxamide |
| SMILES | CCOc1ccccc1NC(=O)N1CCC[C@](C)(C(=O)NCc2ccccc2)C1 |
| InChI | InChI=1S/C23H29N3O3/c1-3-29-20-13-8-7-12-19(20)25-22(28)26-15-9-14-23(2,17-26)21(27)24-16-18-10-5-4-6-11-18/h4-8,10-13H,3,9,14-17H2,1-2H3,(H,24,27)(H,25,28)/t23-/m0/s1 |
| InChIKey | UJTAXFOBMUOCBC-QHCPKHFHSA-N |
| XLogP | 4.04 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |