C23H29N3O4 — CID 95088047
(3S)-3-N-benzyl-1-N-(3,4-dimethoxyphenyl)-3-methylpiperidine-1,3-dicarboxamide (PubChem CID 95088047) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is (3S)-3-N-benzyl-1-N-(3,4-dimethoxyphenyl)-3-methylpiperidine-1,3-dicarboxamide.
| Compound Name | (3S)-3-N-benzyl-1-N-(3,4-dimethoxyphenyl)-3-methylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 95088047 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | (3S)-3-N-benzyl-1-N-(3,4-dimethoxyphenyl)-3-methylpiperidine-1,3-dicarboxamide |
| SMILES | COc1ccc(NC(=O)N2CCC[C@](C)(C(=O)NCc3ccccc3)C2)cc1OC |
| InChI | InChI=1S/C23H29N3O4/c1-23(21(27)24-15-17-8-5-4-6-9-17)12-7-13-26(16-23)22(28)25-18-10-11-19(29-2)20(14-18)30-3/h4-6,8-11,14H,7,12-13,15-16H2,1-3H3,(H,24,27)(H,25,28)/t23-/m0/s1 |
| InChIKey | HPWYMDBMRAQHJA-QHCPKHFHSA-N |
| XLogP | 3.65 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |