C15H20N2O4 — CID 122016522
4-[[[(1R,2R)-2-methoxycyclopentyl]carbamoylamino]methyl]benzoic acid (PubChem CID 122016522) has the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. Its IUPAC name is 4-[[[(1R,2R)-2-methoxycyclopentyl]carbamoylamino]methyl]benzoic acid.
| Compound Name | 4-[[[(1R,2R)-2-methoxycyclopentyl]carbamoylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122016522 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 4-[[[(1R,2R)-2-methoxycyclopentyl]carbamoylamino]methyl]benzoic acid |
| SMILES | CO[C@@H]1CCC[C@H]1NC(=O)NCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C15H20N2O4/c1-21-13-4-2-3-12(13)17-15(20)16-9-10-5-7-11(8-6-10)14(18)19/h5-8,12-13H,2-4,9H2,1H3,(H,18,19)(H2,16,17,20)/t12-,13-/m1/s1 |
| InChIKey | QCIIMTSLYYBZSW-CHWSQXEVSA-N |
| XLogP | 1.75 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |