C18H23N3O5 — CID 122014707
4-[[[6-oxo-2-(oxolan-2-yl)piperidin-3-yl]carbamoylamino]methyl]benzoic acid (PubChem CID 122014707) has the molecular formula C18H23N3O5 and a molecular weight of 361.40 g/mol. Its IUPAC name is 4-[[[6-oxo-2-(oxolan-2-yl)piperidin-3-yl]carbamoylamino]methyl]benzoic acid.
| Compound Name | 4-[[[6-oxo-2-(oxolan-2-yl)piperidin-3-yl]carbamoylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122014707 |
| Molecular Formula | C18H23N3O5 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 4-[[[6-oxo-2-(oxolan-2-yl)piperidin-3-yl]carbamoylamino]methyl]benzoic acid |
| SMILES | O=C1CCC(NC(=O)NCc2ccc(C(=O)O)cc2)C(C2CCCO2)N1 |
| InChI | InChI=1S/C18H23N3O5/c22-15-8-7-13(16(21-15)14-2-1-9-26-14)20-18(25)19-10-11-3-5-12(6-4-11)17(23)24/h3-6,13-14,16H,1-2,7-10H2,(H,21,22)(H,23,24)(H2,19,20,25) |
| InChIKey | MYUIMVKVHNHWET-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |