C17H24N2O2S — CID 97226923
1-[(3aR,4R,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]-3-[(4-methylsulfanylphenyl)methyl]urea (PubChem CID 97226923) has the molecular formula C17H24N2O2S and a molecular weight of 320.46 g/mol. Its IUPAC name is 1-[(3aR,4R,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]-3-[(4-methylsulfanylphenyl)methyl]urea.
| Compound Name | 1-[(3aR,4R,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]-3-[(4-methylsulfanylphenyl)methyl]urea |
|---|---|
| PubChem CID | 97226923 |
| Molecular Formula | C17H24N2O2S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 1-[(3aR,4R,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]-3-[(4-methylsulfanylphenyl)methyl]urea |
| SMILES | CSc1ccc(CNC(=O)N[C@@H]2CCC[C@H]3OCC[C@H]23)cc1 |
| InChI | InChI=1S/C17H24N2O2S/c1-22-13-7-5-12(6-8-13)11-18-17(20)19-15-3-2-4-16-14(15)9-10-21-16/h5-8,14-16H,2-4,9-11H2,1H3,(H2,18,19,20)/t14-,15-,16-/m1/s1 |
| InChIKey | VBMSIUWXECMJKK-BZUAXINKSA-N |
| XLogP | 3.17 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |