C19H29N3O2 — CID 129429567
1-[(3aS,4R,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]-3-[[4-(propylamino)phenyl]methyl]urea (PubChem CID 129429567) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 1-[(3aS,4R,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]-3-[[4-(propylamino)phenyl]methyl]urea.
| Compound Name | 1-[(3aS,4R,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]-3-[[4-(propylamino)phenyl]methyl]urea |
|---|---|
| PubChem CID | 129429567 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 1-[(3aS,4R,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]-3-[[4-(propylamino)phenyl]methyl]urea |
| SMILES | CCCNc1ccc(CNC(=O)N[C@@H]2CCC[C@H]3OCC[C@@H]23)cc1 |
| InChI | InChI=1S/C19H29N3O2/c1-2-11-20-15-8-6-14(7-9-15)13-21-19(23)22-17-4-3-5-18-16(17)10-12-24-18/h6-9,16-18,20H,2-5,10-13H2,1H3,(H2,21,22,23)/t16-,17+,18+/m0/s1 |
| InChIKey | ZLMPVVDECWGPPX-RCCFBDPRSA-N |
| XLogP | 3.27 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |