C15H21N3O2 — CID 97225989
1-[(3aR,4R,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]-3-(pyridin-2-ylmethyl)urea (PubChem CID 97225989) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 1-[(3aR,4R,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]-3-(pyridin-2-ylmethyl)urea.
| Compound Name | 1-[(3aR,4R,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]-3-(pyridin-2-ylmethyl)urea |
|---|---|
| PubChem CID | 97225989 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 1-[(3aR,4R,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]-3-(pyridin-2-ylmethyl)urea |
| SMILES | O=C(NCc1ccccn1)N[C@@H]1CCC[C@H]2OCC[C@H]12 |
| InChI | InChI=1S/C15H21N3O2/c19-15(17-10-11-4-1-2-8-16-11)18-13-5-3-6-14-12(13)7-9-20-14/h1-2,4,8,12-14H,3,5-7,9-10H2,(H2,17,18,19)/t12-,13-,14-/m1/s1 |
| InChIKey | AQOLKAMAOGSBNA-MGPQQGTHSA-N |
| XLogP | 1.84 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |