C15H23N3O2S — CID 97058744
1-[(1S,3R)-3-[(R)-ethylsulfinyl]cyclohexyl]-3-(pyridin-2-ylmethyl)urea (PubChem CID 97058744) has the molecular formula C15H23N3O2S and a molecular weight of 309.43 g/mol. Its IUPAC name is 1-[(1S,3R)-3-[(R)-ethylsulfinyl]cyclohexyl]-3-(pyridin-2-ylmethyl)urea.
| Compound Name | 1-[(1S,3R)-3-[(R)-ethylsulfinyl]cyclohexyl]-3-(pyridin-2-ylmethyl)urea |
|---|---|
| PubChem CID | 97058744 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 1-[(1S,3R)-3-[(R)-ethylsulfinyl]cyclohexyl]-3-(pyridin-2-ylmethyl)urea |
| SMILES | CC[S@@](=O)[C@@H]1CCC[C@H](NC(=O)NCc2ccccn2)C1 |
| InChI | InChI=1S/C15H23N3O2S/c1-2-21(20)14-8-5-7-12(10-14)18-15(19)17-11-13-6-3-4-9-16-13/h3-4,6,9,12,14H,2,5,7-8,10-11H2,1H3,(H2,17,18,19)/t12-,14+,21+/m0/s1 |
| InChIKey | VKUIFYWCKDQJSX-DEOKDLAOSA-N |
| XLogP | 1.96 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |