C19H34IN5OS — CID 109441190
1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-[4-(pyridin-2-ylamino)butyl]guanidine;hydroiodide (PubChem CID 109441190) has the molecular formula C19H34IN5OS and a molecular weight of 507.49 g/mol. Its IUPAC name is 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-[4-(pyridin-2-ylamino)butyl]guanidine;hydroiodide.
| Compound Name | 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-[4-(pyridin-2-ylamino)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109441190 |
| Molecular Formula | C19H34IN5OS |
| Molecular Weight | 507.49 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-[4-(pyridin-2-ylamino)butyl]guanidine;hydroiodide |
| SMILES | CCS(=O)C1CCCC(N/C(=N/C)NCCCCNc2ccccn2)C1.I |
| InChI | InChI=1S/C19H33N5OS.HI/c1-3-26(25)17-10-8-9-16(15-17)24-19(20-2)23-14-7-6-13-22-18-11-4-5-12-21-18;/h4-5,11-12,16-17H,3,6-10,13-15H2,1-2H3,(H,21,22)(H2,20,23,24);1H |
| InChIKey | HCQROASIONPFTQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|