C17H26N2O3S — CID 98787728
1-[(1R,3R)-3-[(S)-ethylsulfinyl]cyclohexyl]-3-[2-(methoxymethyl)phenyl]urea (PubChem CID 98787728) has the molecular formula C17H26N2O3S and a molecular weight of 338.47 g/mol. Its IUPAC name is 1-[(1R,3R)-3-[(S)-ethylsulfinyl]cyclohexyl]-3-[2-(methoxymethyl)phenyl]urea.
| Compound Name | 1-[(1R,3R)-3-[(S)-ethylsulfinyl]cyclohexyl]-3-[2-(methoxymethyl)phenyl]urea |
|---|---|
| PubChem CID | 98787728 |
| Molecular Formula | C17H26N2O3S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 1-[(1R,3R)-3-[(S)-ethylsulfinyl]cyclohexyl]-3-[2-(methoxymethyl)phenyl]urea |
| SMILES | CC[S@](=O)[C@@H]1CCC[C@@H](NC(=O)Nc2ccccc2COC)C1 |
| InChI | InChI=1S/C17H26N2O3S/c1-3-23(21)15-9-6-8-14(11-15)18-17(20)19-16-10-5-4-7-13(16)12-22-2/h4-5,7,10,14-15H,3,6,8-9,11-12H2,1-2H3,(H2,18,19,20)/t14-,15-,23+/m1/s1 |
| InChIKey | CDYORFNPKLFADN-WBPRFABPSA-N |
| XLogP | 3.03 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |