C14H18N2O3 — CID 100910792
N-[(3aS,4R,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]-3-hydroxypyridine-2-carboxamide (PubChem CID 100910792) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is N-[(3aS,4R,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]-3-hydroxypyridine-2-carboxamide.
| Compound Name | N-[(3aS,4R,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]-3-hydroxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 100910792 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | N-[(3aS,4R,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]-3-hydroxypyridine-2-carboxamide |
| SMILES | O=C(N[C@@H]1CCC[C@H]2OCC[C@@H]12)c1ncccc1O |
| InChI | InChI=1S/C14H18N2O3/c17-11-4-2-7-15-13(11)14(18)16-10-3-1-5-12-9(10)6-8-19-12/h2,4,7,9-10,12,17H,1,3,5-6,8H2,(H,16,18)/t9-,10+,12+/m0/s1 |
| InChIKey | WHMSCNYQUIFGIN-HOSYDEDBSA-N |
| XLogP | 1.47 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |