C20H30N4O2 — CID 127909650
4-N,6-N-bis(2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl)pyrimidine-4,6-diamine (PubChem CID 127909650) has the molecular formula C20H30N4O2 and a molecular weight of 358.49 g/mol. Its IUPAC name is 4-N,6-N-bis(2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl)pyrimidine-4,6-diamine.
| Compound Name | 4-N,6-N-bis(2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 127909650 |
| Molecular Formula | C20H30N4O2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | 4-N,6-N-bis(2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl)pyrimidine-4,6-diamine |
| SMILES | c1nc(NC2CCCC3OCCC23)cc(NC2CCCC3OCCC23)n1 |
| InChI | InChI=1S/C20H30N4O2/c1-3-15(13-7-9-25-17(13)5-1)23-19-11-20(22-12-21-19)24-16-4-2-6-18-14(16)8-10-26-18/h11-18H,1-10H2,(H2,21,22,23,24) |
| InChIKey | NJPGENKLBPFXHE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |