C16H18FN3O2S — CID 99616685
N-[(3aR,4R,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]-6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide (PubChem CID 99616685) has the molecular formula C16H18FN3O2S and a molecular weight of 335.40 g/mol. Its IUPAC name is N-[(3aR,4R,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]-6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide.
| Compound Name | N-[(3aR,4R,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]-6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 99616685 |
| Molecular Formula | C16H18FN3O2S |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | N-[(3aR,4R,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]-6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide |
| SMILES | O=C(N[C@@H]1CCC[C@H]2OCC[C@H]12)c1cc(F)cc2[nH]c(=S)[nH]c12 |
| InChI | InChI=1S/C16H18FN3O2S/c17-8-6-10(14-12(7-8)19-16(23)20-14)15(21)18-11-2-1-3-13-9(11)4-5-22-13/h6-7,9,11,13H,1-5H2,(H,18,21)(H2,19,20,23)/t9-,11-,13-/m1/s1 |
| InChIKey | QWYBXNCDDYWYCR-IRUJWGPZSA-N |
| XLogP | 3.05 |
| TPSA | 69.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|