C15H10FN3O3S — CID 78903901
N-(1,3-benzodioxol-5-yl)-6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide (PubChem CID 78903901) has the molecular formula C15H10FN3O3S and a molecular weight of 331.33 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 78903901 |
| Molecular Formula | C15H10FN3O3S |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)c1cc(F)cc2[nH]c(=S)[nH]c12 |
| InChI | InChI=1S/C15H10FN3O3S/c16-7-3-9(13-10(4-7)18-15(23)19-13)14(20)17-8-1-2-11-12(5-8)22-6-21-11/h1-5H,6H2,(H,17,20)(H2,18,19,23) |
| InChIKey | RARYLBOWFJDYEG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 79.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|