C15H8ClF4N3OS — CID 78903769
N-[4-chloro-3-(trifluoromethyl)phenyl]-6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide (PubChem CID 78903769) has the molecular formula C15H8ClF4N3OS and a molecular weight of 389.76 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 78903769 |
| Molecular Formula | C15H8ClF4N3OS |
| Molecular Weight | 389.76 g/mol |
| Exact Mass | 389.00 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(C(F)(F)F)c1)c1cc(F)cc2[nH]c(=S)[nH]c12 |
| InChI | InChI=1S/C15H8ClF4N3OS/c16-10-2-1-7(5-9(10)15(18,19)20)21-13(24)8-3-6(17)4-11-12(8)23-14(25)22-11/h1-5H,(H,21,24)(H2,22,23,25) |
| InChIKey | XEXVQHLTRMVDPP-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.76 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|