C11H12FN3OS — CID 78903906
6-fluoro-N-propyl-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide (PubChem CID 78903906) has the molecular formula C11H12FN3OS and a molecular weight of 253.30 g/mol. Its IUPAC name is 6-fluoro-N-propyl-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide.
| Compound Name | 6-fluoro-N-propyl-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 78903906 |
| Molecular Formula | C11H12FN3OS |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 6-fluoro-N-propyl-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide |
| SMILES | CCCNC(=O)c1cc(F)cc2[nH]c(=S)[nH]c12 |
| InChI | InChI=1S/C11H12FN3OS/c1-2-3-13-10(16)7-4-6(12)5-8-9(7)15-11(17)14-8/h4-5H,2-3H2,1H3,(H,13,16)(H2,14,15,17) |
| InChIKey | KFNJVNBWERCTPJ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|