C16H13F2N3OS — CID 78903908
6-fluoro-N-[2-(4-fluorophenyl)ethyl]-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide (PubChem CID 78903908) has the molecular formula C16H13F2N3OS and a molecular weight of 333.36 g/mol. Its IUPAC name is 6-fluoro-N-[2-(4-fluorophenyl)ethyl]-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide.
| Compound Name | 6-fluoro-N-[2-(4-fluorophenyl)ethyl]-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 78903908 |
| Molecular Formula | C16H13F2N3OS |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 6-fluoro-N-[2-(4-fluorophenyl)ethyl]-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide |
| SMILES | O=C(NCCc1ccc(F)cc1)c1cc(F)cc2[nH]c(=S)[nH]c12 |
| InChI | InChI=1S/C16H13F2N3OS/c17-10-3-1-9(2-4-10)5-6-19-15(22)12-7-11(18)8-13-14(12)21-16(23)20-13/h1-4,7-8H,5-6H2,(H,19,22)(H2,20,21,23) |
| InChIKey | DVABXUPRFSYDOM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|