C23H28FN5OS — CID 78903550
6-fluoro-N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide (PubChem CID 78903550) has the molecular formula C23H28FN5OS and a molecular weight of 441.58 g/mol. Its IUPAC name is 6-fluoro-N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide.
| Compound Name | 6-fluoro-N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 78903550 |
| Molecular Formula | C23H28FN5OS |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | 6-fluoro-N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide |
| SMILES | Cc1cccc(N2CCN(CCCCNC(=O)c3cc(F)cc4[nH]c(=S)[nH]c34)CC2)c1 |
| InChI | InChI=1S/C23H28FN5OS/c1-16-5-4-6-18(13-16)29-11-9-28(10-12-29)8-3-2-7-25-22(30)19-14-17(24)15-20-21(19)27-23(31)26-20/h4-6,13-15H,2-3,7-12H2,1H3,(H,25,30)(H2,26,27,31) |
| InChIKey | BZBVWORNWCCZTQ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|