C14H18FN3O2S — CID 111484162
6-fluoro-N-(2-hydroxy-2,3-dimethylbutyl)-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide (PubChem CID 111484162) has the molecular formula C14H18FN3O2S and a molecular weight of 311.38 g/mol. Its IUPAC name is 6-fluoro-N-(2-hydroxy-2,3-dimethylbutyl)-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide.
| Compound Name | 6-fluoro-N-(2-hydroxy-2,3-dimethylbutyl)-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 111484162 |
| Molecular Formula | C14H18FN3O2S |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 6-fluoro-N-(2-hydroxy-2,3-dimethylbutyl)-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide |
| SMILES | CC(C)C(C)(O)CNC(=O)c1cc(F)cc2[nH]c(=S)[nH]c12 |
| InChI | InChI=1S/C14H18FN3O2S/c1-7(2)14(3,20)6-16-12(19)9-4-8(15)5-10-11(9)18-13(21)17-10/h4-5,7,20H,6H2,1-3H3,(H,16,19)(H2,17,18,21) |
| InChIKey | ROQKRKFNJLYURR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|