C15H22FNO2 — CID 111446571
5-fluoro-N-(2-hydroxy-2,3-dimethylpentyl)-2-methylbenzamide (PubChem CID 111446571) has the molecular formula C15H22FNO2 and a molecular weight of 267.34 g/mol. Its IUPAC name is 5-fluoro-N-(2-hydroxy-2,3-dimethylpentyl)-2-methylbenzamide.
| Compound Name | 5-fluoro-N-(2-hydroxy-2,3-dimethylpentyl)-2-methylbenzamide |
|---|---|
| PubChem CID | 111446571 |
| Molecular Formula | C15H22FNO2 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 5-fluoro-N-(2-hydroxy-2,3-dimethylpentyl)-2-methylbenzamide |
| SMILES | CCC(C)C(C)(O)CNC(=O)c1cc(F)ccc1C |
| InChI | InChI=1S/C15H22FNO2/c1-5-11(3)15(4,19)9-17-14(18)13-8-12(16)7-6-10(13)2/h6-8,11,19H,5,9H2,1-4H3,(H,17,18) |
| InChIKey | LDTRWCUXMDHWFG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |