C16H25NO2 — CID 111446501
N-(2-hydroxy-2,3-dimethylpentyl)-2,4-dimethylbenzamide (PubChem CID 111446501) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is N-(2-hydroxy-2,3-dimethylpentyl)-2,4-dimethylbenzamide.
| Compound Name | N-(2-hydroxy-2,3-dimethylpentyl)-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 111446501 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | N-(2-hydroxy-2,3-dimethylpentyl)-2,4-dimethylbenzamide |
| SMILES | CCC(C)C(C)(O)CNC(=O)c1ccc(C)cc1C |
| InChI | InChI=1S/C16H25NO2/c1-6-13(4)16(5,19)10-17-15(18)14-8-7-11(2)9-12(14)3/h7-9,13,19H,6,10H2,1-5H3,(H,17,18) |
| InChIKey | LYCOMSBECZQVQF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |