C13H16FN3O3S2 — CID 99716288
6-fluoro-N-[(2S)-4-methylsulfonylbutan-2-yl]-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide (PubChem CID 99716288) has the molecular formula C13H16FN3O3S2 and a molecular weight of 345.42 g/mol. Its IUPAC name is 6-fluoro-N-[(2S)-4-methylsulfonylbutan-2-yl]-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide.
| Compound Name | 6-fluoro-N-[(2S)-4-methylsulfonylbutan-2-yl]-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 99716288 |
| Molecular Formula | C13H16FN3O3S2 |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | 6-fluoro-N-[(2S)-4-methylsulfonylbutan-2-yl]-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide |
| SMILES | C[C@@H](CCS(C)(=O)=O)NC(=O)c1cc(F)cc2[nH]c(=S)[nH]c12 |
| InChI | InChI=1S/C13H16FN3O3S2/c1-7(3-4-22(2,19)20)15-12(18)9-5-8(14)6-10-11(9)17-13(21)16-10/h5-7H,3-4H2,1-2H3,(H,15,18)(H2,16,17,21)/t7-/m0/s1 |
| InChIKey | JKNOVOYLMLYHSS-ZETCQYMHSA-N |
| XLogP | 1.92 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|