C17H13F4N3O2S — CID 78905477
6-fluoro-2-sulfanylidene-N-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]-1,3-dihydrobenzimidazole-4-carboxamide (PubChem CID 78905477) has the molecular formula C17H13F4N3O2S and a molecular weight of 399.37 g/mol. Its IUPAC name is 6-fluoro-2-sulfanylidene-N-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]-1,3-dihydrobenzimidazole-4-carboxamide.
| Compound Name | 6-fluoro-2-sulfanylidene-N-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]-1,3-dihydrobenzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 78905477 |
| Molecular Formula | C17H13F4N3O2S |
| Molecular Weight | 399.37 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | 6-fluoro-2-sulfanylidene-N-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]-1,3-dihydrobenzimidazole-4-carboxamide |
| SMILES | O=C(NCc1cccc(OCC(F)(F)F)c1)c1cc(F)cc2[nH]c(=S)[nH]c12 |
| InChI | InChI=1S/C17H13F4N3O2S/c18-10-5-12(14-13(6-10)23-16(27)24-14)15(25)22-7-9-2-1-3-11(4-9)26-8-17(19,20)21/h1-6H,7-8H2,(H,22,25)(H2,23,24,27) |
| InChIKey | QUIVKVDDBHRWGE-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 69.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.37 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|